books examples of naming alkanes
If you do not find what you're looking for, you can use more accurate words.
# Nomenclature of alkanes saturated hydrocarbons
# How to name alkanes
# Alkanes and how they react
# Sources of alkanes in nature
# alkanes compounds
# properties of alkanes
# On the importance and uses of alkanes
# Chloroalkanes
# fluoroalkanes
# Examples of naming organic compounds
# cyclic alkanes
# higher alkanes
# alkanes organic chemistry
# Preparation of alkanes
# Alkanes in organic chemistry
# Preparation and reaction of alkanes
# Reference chemistry of organic alkanes
# About alkanes and methods of preparation
# Physical chemistry, the importance of alkanes
# Organic chemistry about the importance of alkanes
View more
Source: mawdoo3.com
أمثلة على تسمية الألكانات (Info)
فيما يأتي أمثلة على تسمية الألكانات:
- المثال الأول: CH3-CH (CH3)-CH2-CH(CH2-CH3)-CH2-CH3
- يتم تسميته على النحو الآتي: 4-إيثيل-2-ميثيل هكسان.
- المثال الثاني: CH3-CH2- CH(CH3)-CH(CH2-CH3)-CH2-CH3
- يتم تسميته على النحو الآتي: 3-إيثيل-4-ميثيل هكسان.
- المثال الثالث: CH3-CH(CH3)-CH(Br)-CH3
- يتم تسميته على النحو الآتي: 2-برومو-3-ميثيل بيوتان.
